2-methylquinoline;phosphoric acid
Catalog No: FT-0752715
CAS No: 118896-93-8
- Chemical Name: 2-methylquinoline;phosphoric acid
- Molecular Formula: C10H12NO4P
- Molecular Weight: 241.18
- InChI Key: RQCUDCLBKWDRRL-UHFFFAOYSA-N
- InChI: InChI=1S/C10H9N.H3O4P/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-5(2,3)4/h2-7H,1H3;(H3,1,2,3,4)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 118896-93-8 |
|---|---|
| MF: | C10H12NO4P |
| Density: | 1.06 g/mL(lit.) |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 2-methylquinoline,phosphoric acid |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 241.18000 |
| MF: | C10H12NO4P |
|---|---|
| LogP: | 1.61460 |
| Exact_Mass: | 241.05000 |
| Density: | 1.06 g/mL(lit.) |
| FW: | 241.18000 |
| PSA: | 100.46000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | 36 |
| Warning_Statement: | P280 |
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | 21/22 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)